C14H22O7 — CID 90187084
1-[2-(2-methylprop-2-enoyloxy)propoxyperoxy]propan-2-yl 2-methylprop-2-enoate (PubChem CID 90187084) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is 1-[2-(2-methylprop-2-enoyloxy)propoxyperoxy]propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-[2-(2-methylprop-2-enoyloxy)propoxyperoxy]propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90187084 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-[2-(2-methylprop-2-enoyloxy)propoxyperoxy]propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)COOOCC(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C14H22O7/c1-9(2)13(15)19-11(5)7-17-21-18-8-12(6)20-14(16)10(3)4/h11-12H,1,3,7-8H2,2,4-6H3 |
| InChIKey | LHSYPSOVJJRMHC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|