C23H38O9 — CID 91261789
2-(2-methoxypropoxy)ethyl 2-methylprop-2-enoate;2-[2-(2-methylprop-2-enoyloxy)propoxy]ethyl 2-methylprop-2-enoate (PubChem CID 91261789) has the molecular formula C23H38O9 and a molecular weight of 458.55 g/mol. Its IUPAC name is 2-(2-methoxypropoxy)ethyl 2-methylprop-2-enoate;2-[2-(2-methylprop-2-enoyloxy)propoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-methoxypropoxy)ethyl 2-methylprop-2-enoate;2-[2-(2-methylprop-2-enoyloxy)propoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91261789 |
| Molecular Formula | C23H38O9 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 2-(2-methoxypropoxy)ethyl 2-methylprop-2-enoate;2-[2-(2-methylprop-2-enoyloxy)propoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCC(C)OC.C=C(C)C(=O)OCCOCC(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C13H20O5.C10H18O4/c1-9(2)12(14)17-7-6-16-8-11(5)18-13(15)10(3)4;1-8(2)10(11)14-6-5-13-7-9(3)12-4/h11H,1,3,6-8H2,2,4-5H3;9H,1,5-7H2,2-4H3 |
| InChIKey | RRAYVVJTNVJXQZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|