C10H18O4 — CID 20625798
2-(2-methoxypropoxy)ethyl 2-methylprop-2-enoate (PubChem CID 20625798) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-(2-methoxypropoxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-methoxypropoxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20625798 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-(2-methoxypropoxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCC(C)OC |
| InChI | InChI=1S/C10H18O4/c1-8(2)10(11)14-6-5-13-7-9(3)12-4/h9H,1,5-7H2,2-4H3 |
| InChIKey | DSNDCRHHTWONPD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|