C8H15O3P — CID 150780600
2-(2-phosphanylethoxy)ethyl 2-methylprop-2-enoate (PubChem CID 150780600) has the molecular formula C8H15O3P and a molecular weight of 190.18 g/mol. Its IUPAC name is 2-(2-phosphanylethoxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-phosphanylethoxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150780600 |
| Molecular Formula | C8H15O3P |
| Molecular Weight | 190.18 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 2-(2-phosphanylethoxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCP |
| InChI | InChI=1S/C8H15O3P/c1-7(2)8(9)11-4-3-10-5-6-12/h1,3-6,12H2,2H3 |
| InChIKey | KBUCGSOZORPNMN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|