C7H14O5P+ — CID 154142538
trihydroxy-[2-(2-methylprop-2-enoyloxy)propyl]phosphanium (PubChem CID 154142538) has the molecular formula C7H14O5P+ and a molecular weight of 209.16 g/mol. Its IUPAC name is trihydroxy-[2-(2-methylprop-2-enoyloxy)propyl]phosphanium.
| Compound Name | trihydroxy-[2-(2-methylprop-2-enoyloxy)propyl]phosphanium |
|---|---|
| PubChem CID | 154142538 |
| Molecular Formula | C7H14O5P+ |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | trihydroxy-[2-(2-methylprop-2-enoyloxy)propyl]phosphanium |
| SMILES | C=C(C)C(=O)OC(C)C[P+](O)(O)O |
| InChI | InChI=1S/C7H14O5P/c1-5(2)7(8)12-6(3)4-13(9,10)11/h6,9-11H,1,4H2,2-3H3/q+1 |
| InChIKey | IHZUGCBTOZUWJS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|