C12H21O6P — CID 58974136
3-[ethyl-[2-(2-methylprop-2-enoyloxy)propoxy]phosphoryl]propanoic acid (PubChem CID 58974136) has the molecular formula C12H21O6P and a molecular weight of 292.27 g/mol. Its IUPAC name is 3-[ethyl-[2-(2-methylprop-2-enoyloxy)propoxy]phosphoryl]propanoic acid.
| Compound Name | 3-[ethyl-[2-(2-methylprop-2-enoyloxy)propoxy]phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 58974136 |
| Molecular Formula | C12H21O6P |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-[ethyl-[2-(2-methylprop-2-enoyloxy)propoxy]phosphoryl]propanoic acid |
| SMILES | C=C(C)C(=O)OC(C)COP(=O)(CC)CCC(=O)O |
| InChI | InChI=1S/C12H21O6P/c1-5-19(16,7-6-11(13)14)17-8-10(4)18-12(15)9(2)3/h10H,2,5-8H2,1,3-4H3,(H,13,14) |
| InChIKey | AGOJIYLUANPBLM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|