C13H20O6 — CID 87076914
6-[2-(2-methylprop-2-enoyloxy)propoxy]-6-oxohexanoic acid (PubChem CID 87076914) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is 6-[2-(2-methylprop-2-enoyloxy)propoxy]-6-oxohexanoic acid.
| Compound Name | 6-[2-(2-methylprop-2-enoyloxy)propoxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 87076914 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 6-[2-(2-methylprop-2-enoyloxy)propoxy]-6-oxohexanoic acid |
| SMILES | C=C(C)C(=O)OC(C)COC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C13H20O6/c1-9(2)13(17)19-10(3)8-18-12(16)7-5-4-6-11(14)15/h10H,1,4-8H2,2-3H3,(H,14,15) |
| InChIKey | NIOKQFIUPAMLEU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|