C20H35BrO7 — CID 58040730
1-[1-[1-[1-(2-methylprop-2-enoyloxy)propan-2-yloxy]propan-2-yloxy]propan-2-yloxy]propan-2-yl 2-bromo-2-methylpropanoate (PubChem CID 58040730) has the molecular formula C20H35BrO7 and a molecular weight of 467.40 g/mol. Its IUPAC name is 1-[1-[1-[1-(2-methylprop-2-enoyloxy)propan-2-yloxy]propan-2-yloxy]propan-2-yloxy]propan-2-yl 2-bromo-2-methylpropanoate.
| Compound Name | 1-[1-[1-[1-(2-methylprop-2-enoyloxy)propan-2-yloxy]propan-2-yloxy]propan-2-yloxy]propan-2-yl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 58040730 |
| Molecular Formula | C20H35BrO7 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1-[1-[1-[1-(2-methylprop-2-enoyloxy)propan-2-yloxy]propan-2-yloxy]propan-2-yloxy]propan-2-yl 2-bromo-2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCC(C)OCC(C)OCC(C)OCC(C)OC(=O)C(C)(C)Br |
| InChI | InChI=1S/C20H35BrO7/c1-13(2)18(22)27-11-16(5)25-9-14(3)24-10-15(4)26-12-17(6)28-19(23)20(7,8)21/h14-17H,1,9-12H2,2-8H3 |
| InChIKey | GTCHCSSYMGXTSV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|