C12H19NO4 — CID 142512774
2-[[(Z)-but-2-en-2-yl]carbamoyloxy]propyl 2-methylprop-2-enoate (PubChem CID 142512774) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-[[(Z)-but-2-en-2-yl]carbamoyloxy]propyl 2-methylprop-2-enoate.
| Compound Name | 2-[[(Z)-but-2-en-2-yl]carbamoyloxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142512774 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-[[(Z)-but-2-en-2-yl]carbamoyloxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)OC(=O)N/C(C)=C\C |
| InChI | InChI=1S/C12H19NO4/c1-6-9(4)13-12(15)17-10(5)7-16-11(14)8(2)3/h6,10H,2,7H2,1,3-5H3,(H,13,15)/b9-6- |
| InChIKey | ASMVNLRBLPNAFR-TWGQIWQCSA-N |
| XLogP | 2.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|