C13H22O7 — CID 87169157
ethane-1,2-diol;[2-methoxy-2-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate (PubChem CID 87169157) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is ethane-1,2-diol;[2-methoxy-2-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate.
| Compound Name | ethane-1,2-diol;[2-methoxy-2-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87169157 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | ethane-1,2-diol;[2-methoxy-2-(2-methylprop-2-enoyloxy)ethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(OC)OC(=O)C(=C)C.OCCO |
| InChI | InChI=1S/C11H16O5.C2H6O2/c1-7(2)10(12)15-6-9(14-5)16-11(13)8(3)4;3-1-2-4/h9H,1,3,6H2,2,4-5H3;3-4H,1-2H2 |
| InChIKey | DTGCSEQHTLACAV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|