C13H19BrO4 — CID 154123375
[3-bromo-2,2-dimethyl-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate (PubChem CID 154123375) has the molecular formula C13H19BrO4 and a molecular weight of 319.20 g/mol. Its IUPAC name is [3-bromo-2,2-dimethyl-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [3-bromo-2,2-dimethyl-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154123375 |
| Molecular Formula | C13H19BrO4 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | [3-bromo-2,2-dimethyl-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(C)C(Br)OC(=O)C(=C)C |
| InChI | InChI=1S/C13H19BrO4/c1-8(2)10(15)17-7-13(5,6)12(14)18-11(16)9(3)4/h12H,1,3,7H2,2,4-6H3 |
| InChIKey | ZMKBWAFCAZPZAZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|