C23H32O9 — CID 139946038
[3-ethoxy-3-(2-methylprop-2-enoyloxy)-2,2-bis(2-methylprop-2-enoyloxymethyl)propyl] 2-methylprop-2-enoate (PubChem CID 139946038) has the molecular formula C23H32O9 and a molecular weight of 452.50 g/mol. Its IUPAC name is [3-ethoxy-3-(2-methylprop-2-enoyloxy)-2,2-bis(2-methylprop-2-enoyloxymethyl)propyl] 2-methylprop-2-enoate.
| Compound Name | [3-ethoxy-3-(2-methylprop-2-enoyloxy)-2,2-bis(2-methylprop-2-enoyloxymethyl)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139946038 |
| Molecular Formula | C23H32O9 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [3-ethoxy-3-(2-methylprop-2-enoyloxy)-2,2-bis(2-methylprop-2-enoyloxymethyl)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C)(COC(=O)C(=C)C)C(OCC)OC(=O)C(=C)C |
| InChI | InChI=1S/C23H32O9/c1-10-28-22(32-21(27)17(8)9)23(11-29-18(24)14(2)3,12-30-19(25)15(4)5)13-31-20(26)16(6)7/h22H,2,4,6,8,10-13H2,1,3,5,7,9H3 |
| InChIKey | YOLNQYHNARJZKJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|