C19H28O7 — CID 22182119
[4-hydroxy-3-methyl-2,2-bis(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate (PubChem CID 22182119) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is [4-hydroxy-3-methyl-2,2-bis(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate.
| Compound Name | [4-hydroxy-3-methyl-2,2-bis(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22182119 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | [4-hydroxy-3-methyl-2,2-bis(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C)(COC(=O)C(=C)C)C(C)CO |
| InChI | InChI=1S/C19H28O7/c1-12(2)16(21)24-9-19(15(7)8-20,10-25-17(22)13(3)4)11-26-18(23)14(5)6/h15,20H,1,3,5,8-11H2,2,4,6-7H3 |
| InChIKey | QBQMRFDAUDDSSX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|