C12H18O6 — CID 87558283
[2-hydroxy-2-(hydroxymethyl)-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate (PubChem CID 87558283) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is [2-hydroxy-2-(hydroxymethyl)-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-2-(hydroxymethyl)-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87558283 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | [2-hydroxy-2-(hydroxymethyl)-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)(CO)COC(=O)C(=C)C |
| InChI | InChI=1S/C12H18O6/c1-8(2)10(14)17-6-12(16,5-13)7-18-11(15)9(3)4/h13,16H,1,3,5-7H2,2,4H3 |
| InChIKey | IJRZZQJIXOMBPB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|