C12H20O5 — CID 87577994
[2,2-bis(hydroxymethyl)-3-methyl-5-oxopentyl] 2-methylprop-2-enoate (PubChem CID 87577994) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is [2,2-bis(hydroxymethyl)-3-methyl-5-oxopentyl] 2-methylprop-2-enoate.
| Compound Name | [2,2-bis(hydroxymethyl)-3-methyl-5-oxopentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87577994 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [2,2-bis(hydroxymethyl)-3-methyl-5-oxopentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)(CO)C(C)CC=O |
| InChI | InChI=1S/C12H20O5/c1-9(2)11(16)17-8-12(6-14,7-15)10(3)4-5-13/h5,10,14-15H,1,4,6-8H2,2-3H3 |
| InChIKey | ZCSYUQIHHCZJRJ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|