C32H52O10 — CID 159815109
[2,2,4-trimethyl-1-(2-methylprop-2-enoyloxy)pentan-3-yl] 3-oxobutanoate;[2,2,4-trimethyl-3-(2-methylprop-2-enoyloxy)pentyl] 3-oxobutanoate (PubChem CID 159815109) has the molecular formula C32H52O10 and a molecular weight of 596.76 g/mol. Its IUPAC name is [2,2,4-trimethyl-1-(2-methylprop-2-enoyloxy)pentan-3-yl] 3-oxobutanoate;[2,2,4-trimethyl-3-(2-methylprop-2-enoyloxy)pentyl] 3-oxobutanoate.
| Compound Name | [2,2,4-trimethyl-1-(2-methylprop-2-enoyloxy)pentan-3-yl] 3-oxobutanoate;[2,2,4-trimethyl-3-(2-methylprop-2-enoyloxy)pentyl] 3-oxobutanoate |
|---|---|
| PubChem CID | 159815109 |
| Molecular Formula | C32H52O10 |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | [2,2,4-trimethyl-1-(2-methylprop-2-enoyloxy)pentan-3-yl] 3-oxobutanoate;[2,2,4-trimethyl-3-(2-methylprop-2-enoyloxy)pentyl] 3-oxobutanoate |
| SMILES | C=C(C)C(=O)OC(C(C)C)C(C)(C)COC(=O)CC(C)=O.C=C(C)C(=O)OCC(C)(C)C(OC(=O)CC(C)=O)C(C)C |
| InChI | InChI=1S/2C16H26O5/c1-10(2)14(21-13(18)8-12(5)17)16(6,7)9-20-15(19)11(3)4;1-10(2)14(21-15(19)11(3)4)16(6,7)9-20-13(18)8-12(5)17/h2*10,14H,3,8-9H2,1-2,4-7H3 |
| InChIKey | NLNDBWSWRHSOGM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|