C21H28O12 — CID 141429036
[3-methyl-1,1,1-tris(3-oxobutanoyloxy)butan-2-yl] 3-oxobutanoate (PubChem CID 141429036) has the molecular formula C21H28O12 and a molecular weight of 472.44 g/mol. Its IUPAC name is [3-methyl-1,1,1-tris(3-oxobutanoyloxy)butan-2-yl] 3-oxobutanoate.
| Compound Name | [3-methyl-1,1,1-tris(3-oxobutanoyloxy)butan-2-yl] 3-oxobutanoate |
|---|---|
| PubChem CID | 141429036 |
| Molecular Formula | C21H28O12 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | [3-methyl-1,1,1-tris(3-oxobutanoyloxy)butan-2-yl] 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OC(C(C)C)C(OC(=O)CC(C)=O)(OC(=O)CC(C)=O)OC(=O)CC(C)=O |
| InChI | InChI=1S/C21H28O12/c1-11(2)20(30-16(26)7-12(3)22)21(31-17(27)8-13(4)23,32-18(28)9-14(5)24)33-19(29)10-15(6)25/h11,20H,7-10H2,1-6H3 |
| InChIKey | OZCVPNVTKMDGBI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|