C18H24N2O12 — CID 122603309
[1,2-diamino-1,2,2-tris(3-oxobutanoyloxy)ethyl] 3-oxobutanoate (PubChem CID 122603309) has the molecular formula C18H24N2O12 and a molecular weight of 460.39 g/mol. Its IUPAC name is [1,2-diamino-1,2,2-tris(3-oxobutanoyloxy)ethyl] 3-oxobutanoate.
| Compound Name | [1,2-diamino-1,2,2-tris(3-oxobutanoyloxy)ethyl] 3-oxobutanoate |
|---|---|
| PubChem CID | 122603309 |
| Molecular Formula | C18H24N2O12 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | [1,2-diamino-1,2,2-tris(3-oxobutanoyloxy)ethyl] 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OC(N)(OC(=O)CC(C)=O)C(N)(OC(=O)CC(C)=O)OC(=O)CC(C)=O |
| InChI | InChI=1S/C18H24N2O12/c1-9(21)5-13(25)29-17(19,30-14(26)6-10(2)22)18(20,31-15(27)7-11(3)23)32-16(28)8-12(4)24/h5-8,19-20H2,1-4H3 |
| InChIKey | KSLUVERQRSKLKB-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 225.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|