C18H26O9 — CID 121427752
[3-methyl-3,5-bis(3-oxobutanoyloxy)pentyl] 3-oxobutanoate (PubChem CID 121427752) has the molecular formula C18H26O9 and a molecular weight of 386.40 g/mol. Its IUPAC name is [3-methyl-3,5-bis(3-oxobutanoyloxy)pentyl] 3-oxobutanoate.
| Compound Name | [3-methyl-3,5-bis(3-oxobutanoyloxy)pentyl] 3-oxobutanoate |
|---|---|
| PubChem CID | 121427752 |
| Molecular Formula | C18H26O9 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [3-methyl-3,5-bis(3-oxobutanoyloxy)pentyl] 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCCC(C)(CCOC(=O)CC(C)=O)OC(=O)CC(C)=O |
| InChI | InChI=1S/C18H26O9/c1-12(19)9-15(22)25-7-5-18(4,27-17(24)11-14(3)21)6-8-26-16(23)10-13(2)20/h5-11H2,1-4H3 |
| InChIKey | NVSRJDKLQSTBSK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|