About (3-bromo-3-methylbutyl) 3-oxobutanoate
(3-bromo-3-methylbutyl) 3-oxobutanoate (PubChem CID 174962981) has the molecular formula C9H15BrO3
and a molecular weight of 251.12 g/mol. Its IUPAC name is (3-bromo-3-methylbutyl) 3-oxobutanoate.
Molecular Properties
| Compound Name | (3-bromo-3-methylbutyl) 3-oxobutanoate |
| PubChem CID | 174962981 |
| Molecular Formula | C9H15BrO3 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | (3-bromo-3-methylbutyl) 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCCC(C)(C)Br |
| InChI | InChI=1S/C9H15BrO3/c1-7(11)6-8(12)13-5-4-9(2,3)10/h4-6H2,1-3H3 |
| InChIKey | XZOBIXBRKGNLPO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (3-bromo-3-methylbutyl) 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-3-methylbutyl) 3-oxobutanoate?
The IUPAC name of (3-bromo-3-methylbutyl) 3-oxobutanoate (CID 174962981) is (3-bromo-3-methylbutyl) 3-oxobutanoate.
What is the SMILES notation for (3-bromo-3-methylbutyl) 3-oxobutanoate?
The canonical SMILES for (3-bromo-3-methylbutyl) 3-oxobutanoate is CC(=O)CC(=O)OCCC(C)(C)Br.
What is the InChIKey of (3-bromo-3-methylbutyl) 3-oxobutanoate?
The InChIKey is XZOBIXBRKGNLPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BrO3/c1-7(11)6-8(12)13-5-4-9(2,3)10/h4-6H2,1-3H3.
What are the key properties of (3-bromo-3-methylbutyl) 3-oxobutanoate?
(3-bromo-3-methylbutyl) 3-oxobutanoate has a molecular weight of 251.12 g/mol, XLogP of 2.07, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-3-methylbutyl) 3-oxobutanoate is sourced from PubChem (CID 174962981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).