About 2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate
2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate (PubChem CID 175203959) has the molecular formula C18H27AlO9
and a molecular weight of 414.39 g/mol. Its IUPAC name is 2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate |
| PubChem CID | 175203959 |
| Molecular Formula | C18H27AlO9 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCC[Al](CCOC(=O)CC(C)=O)CCOC(=O)CC(C)=O |
| InChI | InChI=1S/3C6H9O3.Al/c3*1-3-9-6(8)4-5(2)7;/h3*1,3-4H2,2H3; |
| InChIKey | KDKJNBUQNLUVSI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate?
The IUPAC name of 2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate (CID 175203959) is 2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate.
What is the SMILES notation for 2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate?
The canonical SMILES for 2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate is CC(=O)CC(=O)OCC[Al](CCOC(=O)CC(C)=O)CCOC(=O)CC(C)=O.
What is the InChIKey of 2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate?
The InChIKey is KDKJNBUQNLUVSI-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H9O3.Al/c3*1-3-9-6(8)4-5(2)7;/h3*1,3-4H2,2H3;.
What are the key properties of 2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate?
2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate has a molecular weight of 414.39 g/mol, XLogP of 1.05, 15 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis[2-(3-oxobutanoyloxy)ethyl]alumanyl]ethyl 3-oxobutanoate is sourced from PubChem (CID 175203959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).