C14H24O3 — CID 174834791
3,7-dimethyloct-6-en-3-yl 3-oxobutanoate (PubChem CID 174834791) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 3,7-dimethyloct-6-en-3-yl 3-oxobutanoate.
| Compound Name | 3,7-dimethyloct-6-en-3-yl 3-oxobutanoate |
|---|---|
| PubChem CID | 174834791 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 3,7-dimethyloct-6-en-3-yl 3-oxobutanoate |
| SMILES | CCC(C)(CCC=C(C)C)OC(=O)CC(C)=O |
| InChI | InChI=1S/C14H24O3/c1-6-14(5,9-7-8-11(2)3)17-13(16)10-12(4)15/h8H,6-7,9-10H2,1-5H3 |
| InChIKey | STXUATLZCCWKGO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|