C12H22O3 — CID 10376016
ethyl 2,2-dideuterio-3-hydroxy-3,7-dimethyloct-6-enoate (PubChem CID 10376016) has the molecular formula C12H22O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is ethyl 2,2-dideuterio-3-hydroxy-3,7-dimethyloct-6-enoate.
| Compound Name | ethyl 2,2-dideuterio-3-hydroxy-3,7-dimethyloct-6-enoate |
|---|---|
| PubChem CID | 10376016 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | ethyl 2,2-dideuterio-3-hydroxy-3,7-dimethyloct-6-enoate |
| SMILES | [2H]C([2H])(C(=O)OCC)C(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C12H22O3/c1-5-15-11(13)9-12(4,14)8-6-7-10(2)3/h7,14H,5-6,8-9H2,1-4H3/i9D2 |
| InChIKey | PHYFKXNWJXRGLZ-KNXIQCGSSA-N |
| XLogP | 2.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|