C14H22O4 — CID 102338563
ethyl (3E)-5-hydroxy-5,9-dimethyl-2-oxodeca-3,8-dienoate (PubChem CID 102338563) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is ethyl (3E)-5-hydroxy-5,9-dimethyl-2-oxodeca-3,8-dienoate.
| Compound Name | ethyl (3E)-5-hydroxy-5,9-dimethyl-2-oxodeca-3,8-dienoate |
|---|---|
| PubChem CID | 102338563 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | ethyl (3E)-5-hydroxy-5,9-dimethyl-2-oxodeca-3,8-dienoate |
| SMILES | CCOC(=O)C(=O)/C=C/C(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C14H22O4/c1-5-18-13(16)12(15)8-10-14(4,17)9-6-7-11(2)3/h7-8,10,17H,5-6,9H2,1-4H3/b10-8+ |
| InChIKey | INGQPMMMTCLSPW-CSKARUKUSA-N |
| XLogP | 2.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|