C20H34O2S2 — CID 139888264
1-[(3-hydroxy-3,7-dimethylocta-1,6-dienyl)disulfanyl]-3,7-dimethylocta-1,6-dien-3-ol (PubChem CID 139888264) has the molecular formula C20H34O2S2 and a molecular weight of 370.62 g/mol. Its IUPAC name is 1-[(3-hydroxy-3,7-dimethylocta-1,6-dienyl)disulfanyl]-3,7-dimethylocta-1,6-dien-3-ol.
| Compound Name | 1-[(3-hydroxy-3,7-dimethylocta-1,6-dienyl)disulfanyl]-3,7-dimethylocta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 139888264 |
| Molecular Formula | C20H34O2S2 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 1-[(3-hydroxy-3,7-dimethylocta-1,6-dienyl)disulfanyl]-3,7-dimethylocta-1,6-dien-3-ol |
| SMILES | CC(C)=CCCC(C)(O)C=CSSC=CC(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C20H34O2S2/c1-17(2)9-7-11-19(5,21)13-15-23-24-16-14-20(6,22)12-8-10-18(3)4/h9-10,13-16,21-22H,7-8,11-12H2,1-6H3 |
| InChIKey | UQZIKCOYPVVNBI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|