C20H28O — CID 160961058
1,2-bis(ethenyl)benzene;3,7-dimethylocta-1,6-dien-3-ol (PubChem CID 160961058) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;3,7-dimethylocta-1,6-dien-3-ol.
| Compound Name | 1,2-bis(ethenyl)benzene;3,7-dimethylocta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 160961058 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;3,7-dimethylocta-1,6-dien-3-ol |
| SMILES | C=CC(C)(O)CCC=C(C)C.C=Cc1ccccc1C=C |
| InChI | InChI=1S/C10H18O.C10H10/c1-5-10(4,11)8-6-7-9(2)3;1-3-9-7-5-6-8-10(9)4-2/h5,7,11H,1,6,8H2,2-4H3;3-8H,1-2H2 |
| InChIKey | SXAAHVHSNLALRC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|