C16H32O — CID 135305503
3,7-dimethylocta-1,6-dien-3-ol;hexane (PubChem CID 135305503) has the molecular formula C16H32O and a molecular weight of 240.43 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-dien-3-ol;hexane.
| Compound Name | 3,7-dimethylocta-1,6-dien-3-ol;hexane |
|---|---|
| PubChem CID | 135305503 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | 3,7-dimethylocta-1,6-dien-3-ol;hexane |
| SMILES | C=CC(C)(O)CCC=C(C)C.CCCCCC |
| InChI | InChI=1S/C10H18O.C6H14/c1-5-10(4,11)8-6-7-9(2)3;1-3-5-6-4-2/h5,7,11H,1,6,8H2,2-4H3;3-6H2,1-2H3 |
| InChIKey | XSNVBRHMKKWGKB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|