C20H38O4 — CID 161231365
3,7-dimethylocta-1,6-diene-1,3-diol;2,6-dimethyloct-7-ene-2,6-diol (PubChem CID 161231365) has the molecular formula C20H38O4 and a molecular weight of 342.52 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-diene-1,3-diol;2,6-dimethyloct-7-ene-2,6-diol.
| Compound Name | 3,7-dimethylocta-1,6-diene-1,3-diol;2,6-dimethyloct-7-ene-2,6-diol |
|---|---|
| PubChem CID | 161231365 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | 3,7-dimethylocta-1,6-diene-1,3-diol;2,6-dimethyloct-7-ene-2,6-diol |
| SMILES | C=CC(C)(O)CCCC(C)(C)O.CC(C)=CCCC(C)(O)C=CO |
| InChI | InChI=1S/C10H18O2.C10H20O2/c1-9(2)5-4-6-10(3,12)7-8-11;1-5-10(4,12)8-6-7-9(2,3)11/h5,7-8,11-12H,4,6H2,1-3H3;5,11-12H,1,6-8H2,2-4H3 |
| InChIKey | UYUHCYPUDYOYCB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|