C45H82O5 — CID 73017728
3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-1,6,10,14,34-pentaene-3,19,23,27,31-pentol (PubChem CID 73017728) has the molecular formula C45H82O5 and a molecular weight of 703.15 g/mol. Its IUPAC name is 3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-1,6,10,14,34-pentaene-3,19,23,27,31-pentol.
| Compound Name | 3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-1,6,10,14,34-pentaene-3,19,23,27,31-pentol |
|---|---|
| PubChem CID | 73017728 |
| Molecular Formula | C45H82O5 |
| Molecular Weight | 703.15 g/mol |
| Exact Mass | 702.62 |
| IUPAC Name | 3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-1,6,10,14,34-pentaene-3,19,23,27,31-pentol |
| SMILES | C=CC(C)(O)CCC=C(C)CCC=C(C)CCC=C(C)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C45H82O5/c1-12-41(7,46)28-16-26-39(5)24-13-22-38(4)23-14-25-40(6)27-17-30-43(9,48)32-19-34-45(11,50)36-20-35-44(10,49)33-18-31-42(8,47)29-15-21-37(2)3/h12,21-22,25-26,46-50H,1,13-20,23-24,27-36H2,2-11H3 |
| InChIKey | GPDSPOXDCDDXJY-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.15 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|