C26H48O4 — CID 159991235
acetic acid;nonan-2-one;3,7,11-trimethyldodeca-1,6,10-trien-3-ol (PubChem CID 159991235) has the molecular formula C26H48O4 and a molecular weight of 424.67 g/mol. Its IUPAC name is acetic acid;nonan-2-one;3,7,11-trimethyldodeca-1,6,10-trien-3-ol.
| Compound Name | acetic acid;nonan-2-one;3,7,11-trimethyldodeca-1,6,10-trien-3-ol |
|---|---|
| PubChem CID | 159991235 |
| Molecular Formula | C26H48O4 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.36 |
| IUPAC Name | acetic acid;nonan-2-one;3,7,11-trimethyldodeca-1,6,10-trien-3-ol |
| SMILES | C=CC(C)(O)CCC=C(C)CCC=C(C)C.CC(=O)O.CCCCCCCC(C)=O |
| InChI | InChI=1S/C15H26O.C9H18O.C2H4O2/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3;1-3-4-5-6-7-8-9(2)10;1-2(3)4/h6,9,11,16H,1,7-8,10,12H2,2-5H3;3-8H2,1-2H3;1H3,(H,3,4) |
| InChIKey | UGOGLPIFFKSFFB-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|