C37H64O2 — CID 174641388
heptanoic acid;2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene (PubChem CID 174641388) has the molecular formula C37H64O2 and a molecular weight of 540.92 g/mol. Its IUPAC name is heptanoic acid;2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene.
| Compound Name | heptanoic acid;2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene |
|---|---|
| PubChem CID | 174641388 |
| Molecular Formula | C37H64O2 |
| Molecular Weight | 540.92 g/mol |
| Exact Mass | 540.49 |
| IUPAC Name | heptanoic acid;2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C.CCCCCCC(=O)O |
| InChI | InChI=1S/C30H50.C7H14O2/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4;1-2-3-4-5-6-7(8)9/h15-18,23-24H,9-14,19-22H2,1-8H3;2-6H2,1H3,(H,8,9) |
| InChIKey | ZXOGASKAUZUKEA-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.92 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|