C32H62O3 — CID 175327394
(2E)-3,7-dimethylocta-2,6-dien-1-ol;docosanoic acid (PubChem CID 175327394) has the molecular formula C32H62O3 and a molecular weight of 494.85 g/mol. Its IUPAC name is (2E)-3,7-dimethylocta-2,6-dien-1-ol;docosanoic acid.
| Compound Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;docosanoic acid |
|---|---|
| PubChem CID | 175327394 |
| Molecular Formula | C32H62O3 |
| Molecular Weight | 494.85 g/mol |
| Exact Mass | 494.47 |
| IUPAC Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;docosanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CO.CCCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H44O2.C10H18O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-9(2)5-4-6-10(3)7-8-11/h2-21H2,1H3,(H,23,24);5,7,11H,4,6,8H2,1-3H3/b;10-7+ |
| InChIKey | JYWQSPOWVDODQB-FXRCEOBJSA-N |
| XLogP | 10.56 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.85 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|