C27H52O3 — CID 46913634
(2E)-3,7-dimethylocta-2,6-dien-1-ol;propan-2-yl tetradecanoate (PubChem CID 46913634) has the molecular formula C27H52O3 and a molecular weight of 424.71 g/mol. Its IUPAC name is (2E)-3,7-dimethylocta-2,6-dien-1-ol;propan-2-yl tetradecanoate.
| Compound Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;propan-2-yl tetradecanoate |
|---|---|
| PubChem CID | 46913634 |
| Molecular Formula | C27H52O3 |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.39 |
| IUPAC Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;propan-2-yl tetradecanoate |
| SMILES | CC(C)=CCC/C(C)=C/CO.CCCCCCCCCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C17H34O2.C10H18O/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(18)19-16(2)3;1-9(2)5-4-6-10(3)7-8-11/h16H,4-15H2,1-3H3;5,7,11H,4,6,8H2,1-3H3/b;10-7+ |
| InChIKey | NVGTZUKFUZOFRV-FXRCEOBJSA-N |
| XLogP | 8.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|