C22H44O2 — CID 174942074
(2E)-3,7-dimethylocta-2,6-dien-1-ol;1-hexoxyhexane (PubChem CID 174942074) has the molecular formula C22H44O2 and a molecular weight of 340.59 g/mol. Its IUPAC name is (2E)-3,7-dimethylocta-2,6-dien-1-ol;1-hexoxyhexane.
| Compound Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;1-hexoxyhexane |
|---|---|
| PubChem CID | 174942074 |
| Molecular Formula | C22H44O2 |
| Molecular Weight | 340.59 g/mol |
| Exact Mass | 340.33 |
| IUPAC Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;1-hexoxyhexane |
| SMILES | CC(C)=CCC/C(C)=C/CO.CCCCCCOCCCCCC |
| InChI | InChI=1S/C12H26O.C10H18O/c1-3-5-7-9-11-13-12-10-8-6-4-2;1-9(2)5-4-6-10(3)7-8-11/h3-12H2,1-2H3;5,7,11H,4,6,8H2,1-3H3/b;10-7+ |
| InChIKey | SOUJOMMNTQYETK-FXRCEOBJSA-N |
| XLogP | 6.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.59 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|