C14H26O — CID 141351623
(2E)-3,7-dimethyldodeca-2,6-dien-1-ol (PubChem CID 141351623) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is (2E)-3,7-dimethyldodeca-2,6-dien-1-ol.
| Compound Name | (2E)-3,7-dimethyldodeca-2,6-dien-1-ol |
|---|---|
| PubChem CID | 141351623 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (2E)-3,7-dimethyldodeca-2,6-dien-1-ol |
| SMILES | CCCCCC(C)=CCC/C(C)=C/CO |
| InChI | InChI=1S/C14H26O/c1-4-5-6-8-13(2)9-7-10-14(3)11-12-15/h9,11,15H,4-8,10,12H2,1-3H3/b13-9?,14-11+ |
| InChIKey | BSNJKWDYMXLKBM-ZNNSLDMCSA-N |
| XLogP | 4.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|