About 4-methylnon-3-en-1-amine
4-methylnon-3-en-1-amine (PubChem CID 79593569) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is 4-methylnon-3-en-1-amine.
Molecular Properties
| Compound Name | 4-methylnon-3-en-1-amine |
| PubChem CID | 79593569 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 4-methylnon-3-en-1-amine |
| SMILES | CCCCCC(C)=CCCN |
| InChI | InChI=1S/C10H21N/c1-3-4-5-7-10(2)8-6-9-11/h8H,3-7,9,11H2,1-2H3 |
| InChIKey | GJHWEIXIXWADSQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylnon-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylnon-3-en-1-amine?
The IUPAC name of 4-methylnon-3-en-1-amine (CID 79593569) is 4-methylnon-3-en-1-amine.
What is the SMILES notation for 4-methylnon-3-en-1-amine?
The canonical SMILES for 4-methylnon-3-en-1-amine is CCCCCC(C)=CCCN.
What is the InChIKey of 4-methylnon-3-en-1-amine?
The InChIKey is GJHWEIXIXWADSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N/c1-3-4-5-7-10(2)8-6-9-11/h8H,3-7,9,11H2,1-2H3.
What are the key properties of 4-methylnon-3-en-1-amine?
4-methylnon-3-en-1-amine has a molecular weight of 155.28 g/mol, XLogP of 2.86, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylnon-3-en-1-amine is sourced from PubChem (CID 79593569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).