C19H34 — CID 54031242
3,7,11-trimethylhexadeca-2,6,10-triene (PubChem CID 54031242) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is 3,7,11-trimethylhexadeca-2,6,10-triene.
| Compound Name | 3,7,11-trimethylhexadeca-2,6,10-triene |
|---|---|
| PubChem CID | 54031242 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | 3,7,11-trimethylhexadeca-2,6,10-triene |
| SMILES | CC=C(C)CCC=C(C)CCC=C(C)CCCCC |
| InChI | InChI=1S/C19H34/c1-6-8-9-12-18(4)15-11-16-19(5)14-10-13-17(3)7-2/h7,14-15H,6,8-13,16H2,1-5H3 |
| InChIKey | NYQZLGSOHQYPAE-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|