C19H36O2 — CID 173407117
ethoxyethane;3,7,11-trimethyldodeca-2,6,10-trien-1-ol (PubChem CID 173407117) has the molecular formula C19H36O2 and a molecular weight of 296.50 g/mol. Its IUPAC name is ethoxyethane;3,7,11-trimethyldodeca-2,6,10-trien-1-ol.
| Compound Name | ethoxyethane;3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 173407117 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | ethoxyethane;3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCO.CCOCC |
| InChI | InChI=1S/C15H26O.C4H10O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16;1-3-5-4-2/h7,9,11,16H,5-6,8,10,12H2,1-4H3;3-4H2,1-2H3 |
| InChIKey | UCAVYRDLHJAOAR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|