C22H40O3 — CID 23466441
(2Z,6E)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-6-methylocta-2,6-diene-1,8-diol;methoxymethane (PubChem CID 23466441) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is (2Z,6E)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-6-methylocta-2,6-diene-1,8-diol;methoxymethane.
| Compound Name | (2Z,6E)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-6-methylocta-2,6-diene-1,8-diol;methoxymethane |
|---|---|
| PubChem CID | 23466441 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | (2Z,6E)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-6-methylocta-2,6-diene-1,8-diol;methoxymethane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C/CC/C(C)=C/CO)CO.COC |
| InChI | InChI=1S/C20H34O2.C2H6O/c1-17(2)8-5-9-18(3)10-6-12-20(16-22)13-7-11-19(4)14-15-21;1-3-2/h8,10,13-14,21-22H,5-7,9,11-12,15-16H2,1-4H3;1-2H3/b18-10+,19-14+,20-13-; |
| InChIKey | IRFQTBLVOVKUKG-GYMDSIIMSA-N |
| XLogP | 5.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|