C20H34O — CID 25239942
(2E,4R,6E,10E)-4-deuterio-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol (PubChem CID 25239942) has the molecular formula C20H34O and a molecular weight of 291.50 g/mol. Its IUPAC name is (2E,4R,6E,10E)-4-deuterio-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol.
| Compound Name | (2E,4R,6E,10E)-4-deuterio-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol |
|---|---|
| PubChem CID | 25239942 |
| Molecular Formula | C20H34O |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | (2E,4R,6E,10E)-4-deuterio-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol |
| SMILES | [2H][C@H](C/C=C(\C)CC/C=C(\C)CCC=C(C)C)/C(C)=C/CO |
| InChI | InChI=1S/C20H34O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h9,11,13,15,21H,6-8,10,12,14,16H2,1-5H3/b18-11+,19-13+,20-15+/i14D/t14-/m1/s1 |
| InChIKey | OJISWRZIEWCUBN-UFPIZADHSA-N |
| XLogP | 6.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|