C10H19ClO — CID 126649589
(2E)-3,7-dimethylocta-2,6-dien-1-ol;hydrochloride (PubChem CID 126649589) has the molecular formula C10H19ClO and a molecular weight of 190.71 g/mol. Its IUPAC name is (2E)-3,7-dimethylocta-2,6-dien-1-ol;hydrochloride.
| Compound Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;hydrochloride |
|---|---|
| PubChem CID | 126649589 |
| Molecular Formula | C10H19ClO |
| Molecular Weight | 190.71 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;hydrochloride |
| SMILES | CC(C)=CCC/C(C)=C/CO.Cl |
| InChI | InChI=1S/C10H18O.ClH/c1-9(2)5-4-6-10(3)7-8-11;/h5,7,11H,4,6,8H2,1-3H3;1H/b10-7+; |
| InChIKey | VHAQVYOYIPYPII-HCUGZAAXSA-N |
| XLogP | 3.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|