C14H24O3 — CID 175185571
(E)-but-2-enoic acid;(2E)-3,7-dimethylocta-2,6-dien-1-ol (PubChem CID 175185571) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (E)-but-2-enoic acid;(2E)-3,7-dimethylocta-2,6-dien-1-ol.
| Compound Name | (E)-but-2-enoic acid;(2E)-3,7-dimethylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 175185571 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (E)-but-2-enoic acid;(2E)-3,7-dimethylocta-2,6-dien-1-ol |
| SMILES | C/C=C/C(=O)O.CC(C)=CCC/C(C)=C/CO |
| InChI | InChI=1S/C10H18O.C4H6O2/c1-9(2)5-4-6-10(3)7-8-11;1-2-3-4(5)6/h5,7,11H,4,6,8H2,1-3H3;2-3H,1H3,(H,5,6)/b10-7+;3-2+ |
| InChIKey | YAUZFTBXSZMFMF-DBTBEMPTSA-N |
| XLogP | 3.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|