C14H23NO — CID 11521413
(E)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]but-2-enamide (PubChem CID 11521413) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (E)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]but-2-enamide.
| Compound Name | (E)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]but-2-enamide |
|---|---|
| PubChem CID | 11521413 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (E)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C14H23NO/c1-5-7-14(16)15-11-10-13(4)9-6-8-12(2)3/h5,7-8,10H,6,9,11H2,1-4H3,(H,15,16)/b7-5+,13-10+ |
| InChIKey | OMUJNTMAMJLEMF-XZUSAQEFSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|