C20H33NO — CID 59793401
(2Z)-N-[(2Z)-3,7-dimethylocta-2,6-dienyl]-3,7-dimethylocta-2,6-dienamide (PubChem CID 59793401) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is (2Z)-N-[(2Z)-3,7-dimethylocta-2,6-dienyl]-3,7-dimethylocta-2,6-dienamide.
| Compound Name | (2Z)-N-[(2Z)-3,7-dimethylocta-2,6-dienyl]-3,7-dimethylocta-2,6-dienamide |
|---|---|
| PubChem CID | 59793401 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | (2Z)-N-[(2Z)-3,7-dimethylocta-2,6-dienyl]-3,7-dimethylocta-2,6-dienamide |
| SMILES | CC(C)=CCC/C(C)=C\CNC(=O)/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C20H33NO/c1-16(2)9-7-11-18(5)13-14-21-20(22)15-19(6)12-8-10-17(3)4/h9-10,13,15H,7-8,11-12,14H2,1-6H3,(H,21,22)/b18-13-,19-15- |
| InChIKey | DAFMOQTZWUWDHY-ONPJFLAQSA-N |
| XLogP | 5.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|