C24H38N2O2 — CID 71441350
N,N'-bis(3,7-dimethylocta-2,6-dienyl)but-2-enediamide (PubChem CID 71441350) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is N,N'-bis(3,7-dimethylocta-2,6-dienyl)but-2-enediamide.
| Compound Name | N,N'-bis(3,7-dimethylocta-2,6-dienyl)but-2-enediamide |
|---|---|
| PubChem CID | 71441350 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | N,N'-bis(3,7-dimethylocta-2,6-dienyl)but-2-enediamide |
| SMILES | CC(C)=CCCC(C)=CCNC(=O)C=CC(=O)NCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C24H38N2O2/c1-19(2)9-7-11-21(5)15-17-25-23(27)13-14-24(28)26-18-16-22(6)12-8-10-20(3)4/h9-10,13-16H,7-8,11-12,17-18H2,1-6H3,(H,25,27)(H,26,28) |
| InChIKey | ONZIEPWQNMRXMK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|