C14H23NO2 — CID 151276822
1-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]cyclopropane-1-carboxylic acid (PubChem CID 151276822) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 1-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 151276822 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 1-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]cyclopropane-1-carboxylic acid |
| SMILES | CC(C)=CCC/C(C)=C/CNC1(C(=O)O)CC1 |
| InChI | InChI=1S/C14H23NO2/c1-11(2)5-4-6-12(3)7-10-15-14(8-9-14)13(16)17/h5,7,15H,4,6,8-10H2,1-3H3,(H,16,17)/b12-7+ |
| InChIKey | NXNJSBCTGPEKDT-KPKJPENVSA-N |
| XLogP | 2.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|