C14H25NO — CID 59793391
N-[(2E)-3,7-dimethylocta-2,6-dienyl]butanamide (PubChem CID 59793391) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]butanamide.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]butanamide |
|---|---|
| PubChem CID | 59793391 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]butanamide |
| SMILES | CCCC(=O)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C14H25NO/c1-5-7-14(16)15-11-10-13(4)9-6-8-12(2)3/h8,10H,5-7,9,11H2,1-4H3,(H,15,16)/b13-10+ |
| InChIKey | KARFDVWKHSKYJK-JLHYYAGUSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|