C22H37NO2 — CID 57095589
N-(2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienyl)butanamide (PubChem CID 57095589) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is N-(2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienyl)butanamide.
| Compound Name | N-(2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienyl)butanamide |
|---|---|
| PubChem CID | 57095589 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | N-(2,6,10-trimethyl-14-oxopentadeca-2,6,10-trienyl)butanamide |
| SMILES | CCCC(=O)NCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=O |
| InChI | InChI=1S/C22H37NO2/c1-6-10-22(25)23-17-20(4)15-8-13-18(2)11-7-12-19(3)14-9-16-21(5)24/h11,14-15H,6-10,12-13,16-17H2,1-5H3,(H,23,25) |
| InChIKey | IEOTUTKZIANPDG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|