C20H34O — CID 162428625
(5E,9Z)-6,10,14-trimethylheptadeca-5,9,13-trien-2-one (PubChem CID 162428625) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (5E,9Z)-6,10,14-trimethylheptadeca-5,9,13-trien-2-one.
| Compound Name | (5E,9Z)-6,10,14-trimethylheptadeca-5,9,13-trien-2-one |
|---|---|
| PubChem CID | 162428625 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (5E,9Z)-6,10,14-trimethylheptadeca-5,9,13-trien-2-one |
| SMILES | CCCC(C)=CCC/C(C)=C\CC/C(C)=C/CCC(C)=O |
| InChI | InChI=1S/C20H34O/c1-6-10-17(2)11-7-12-18(3)13-8-14-19(4)15-9-16-20(5)21/h11,13,15H,6-10,12,14,16H2,1-5H3/b17-11?,18-13-,19-15+ |
| InChIKey | LFEYNSQAYKUOKG-RWOGIRFBSA-N |
| XLogP | 6.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|