C14H24O2 — CID 88828035
(5E,9E)-11-methoxy-6,10-dimethylundeca-5,9-dien-2-one (PubChem CID 88828035) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (5E,9E)-11-methoxy-6,10-dimethylundeca-5,9-dien-2-one.
| Compound Name | (5E,9E)-11-methoxy-6,10-dimethylundeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 88828035 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (5E,9E)-11-methoxy-6,10-dimethylundeca-5,9-dien-2-one |
| SMILES | COC/C(C)=C/CC/C(C)=C/CCC(C)=O |
| InChI | InChI=1S/C14H24O2/c1-12(8-6-10-14(3)15)7-5-9-13(2)11-16-4/h8-9H,5-7,10-11H2,1-4H3/b12-8+,13-9+ |
| InChIKey | SGNNTCBXZNBLBJ-QHKWOANTSA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|